Methyl 4-acetamido-2-methoxybenzoate
Catalog No: FT-0635121
CAS No: 4093-29-2
- Chemical Name: Methyl 4-acetamido-2-methoxybenzoate
- Molecular Formula: C11H13NO4
- Molecular Weight: 223.22
- InChI Key: OERVVBDWGVOBIS-UHFFFAOYSA-N
- InChI: InChI=1S/C11H13NO4/c1-7(13)12-8-4-5-9(11(14)16-3)10(6-8)15-2/h4-6H,1-3H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 4093-29-2 |
| Flash_Point: | 206.3±25.9 °C |
| Product_Name: | Methyl 4-acetamido-2-methoxybenzoate |
| Bolling_Point: | 417.5±35.0 °C at 760 mmHg |
| FW: | 223.225 |
| Melting_Point: | 127ºC |
| MF: | C11H13NO4 |
| Density: | 1.2±0.1 g/cm3 |
| Melting_Point: | 127ºC |
|---|---|
| Refractive_Index: | 1.553 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| MF: | C11H13NO4 |
| Flash_Point: | 206.3±25.9 °C |
| LogP: | 1.89 |
| FW: | 223.225 |
| Density: | 1.2±0.1 g/cm3 |
| PSA: | 64.63000 |
| Bolling_Point: | 417.5±35.0 °C at 760 mmHg |
| Exact_Mass: | 223.084457 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2942000000 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)